ChemNet > CAS > 499771-12-9 1-[3-(2,6-dichlorophenyl)isoxazol-5-yl]ethan-1-one
499771-12-9 1-[3-(2,6-dichlorophenyl)isoxazol-5-yl]ethan-1-one
| název výrobku |
1-[3-(2,6-dichlorophenyl)isoxazol-5-yl]ethan-1-one |
| Synonyma |
1-[3-(2,6-dichlorophenyl)isoxazol-5-yl]ethanone |
| Molekulární vzorec |
C11H7Cl2NO2 |
| Molekulová hmotnost |
256.0848 |
| InChI |
InChI=1/C11H7Cl2NO2/c1-6(15)10-5-9(14-16-10)11-7(12)3-2-4-8(11)13/h2-5H,1H3 |
| Registrační číslo CAS |
499771-12-9 |
| Molekulární struktura |
![499771-12-9 1-[3-(2,6-dichlorophenyl)isoxazol-5-yl]ethan-1-one](https://images-a.chemnet.com/suppliers/chembase/163/16328.gif)
|
| Hustota |
1.375g/cm3 |
| Bod tání |
116℃ |
| Bod varu |
389.3°C at 760 mmHg |
| Index lomu |
1.569 |
| Bod vzplanutí |
189.2°C |
| Symbolů nebezpečnosti |
 Xi:Irritant;
|
| Riziko Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
